About N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide
N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide (PubChem CID 11964600) has the molecular formula C14H10F3N5O4S
and a molecular weight of 401.33 g/mol. Its IUPAC name is N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide |
| PubChem CID | 11964600 |
| Molecular Formula | C14H10F3N5O4S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nn1c(=O)[nH]c2cc(C(F)(F)F)c(-c3cccnn3)cc2c1=O |
| InChI | InChI=1S/C14H10F3N5O4S/c1-27(25,26)21-22-12(23)8-5-7(10-3-2-4-18-20-10)9(14(15,16)17)6-11(8)19-13(22)24/h2-6,21H,1H3,(H,19,24) |
| InChIKey | YUWXEUULWSCLFK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
The IUPAC name of N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide (CID 11964600) is N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
The canonical SMILES for N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide is CS(=O)(=O)Nn1c(=O)[nH]c2cc(C(F)(F)F)c(-c3cccnn3)cc2c1=O.
What is the InChIKey of N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
The InChIKey is YUWXEUULWSCLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N5O4S/c1-27(25,26)21-22-12(23)8-5-7(10-3-2-4-18-20-10)9(14(15,16)17)6-11(8)19-13(22)24/h2-6,21H,1H3,(H,19,24).
What are the key properties of N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide has a molecular weight of 401.33 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-dioxo-6-pyridazin-3-yl-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide is sourced from PubChem (CID 11964600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).