C15H30N2OS — CID 119648398
1-[4-(ethylaminomethyl)piperidin-1-yl]-2-ethylsulfanyl-3-methylbutan-1-one (PubChem CID 119648398) has the molecular formula C15H30N2OS and a molecular weight of 286.49 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-ethylsulfanyl-3-methylbutan-1-one.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-ethylsulfanyl-3-methylbutan-1-one |
|---|---|
| PubChem CID | 119648398 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-ethylsulfanyl-3-methylbutan-1-one |
| SMILES | CCNCC1CCN(C(=O)C(SCC)C(C)C)CC1 |
| InChI | InChI=1S/C15H30N2OS/c1-5-16-11-13-7-9-17(10-8-13)15(18)14(12(3)4)19-6-2/h12-14,16H,5-11H2,1-4H3 |
| InChIKey | FKIFNRGIDOFQRX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |