C18H28N2O2 — CID 119648867
4-(2-methoxyphenyl)-3-methyl-1-[2-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one (PubChem CID 119648867) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-3-methyl-1-[2-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-(2-methoxyphenyl)-3-methyl-1-[2-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119648867 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 4-(2-methoxyphenyl)-3-methyl-1-[2-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one |
| SMILES | CNCC1CCCN1C(=O)CC(C)Cc1ccccc1OC |
| InChI | InChI=1S/C18H28N2O2/c1-14(11-15-7-4-5-9-17(15)22-3)12-18(21)20-10-6-8-16(20)13-19-2/h4-5,7,9,14,16,19H,6,8,10-13H2,1-3H3 |
| InChIKey | VRZVOVJJMIPFHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |