C11H18ClN5O3 — CID 119649698
1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone;hydrochloride (PubChem CID 119649698) has the molecular formula C11H18ClN5O3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone;hydrochloride.
| Compound Name | 1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119649698 |
| Molecular Formula | C11H18ClN5O3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)Cn1cc([N+](=O)[O-])cn1.Cl |
| InChI | InChI=1S/C11H17N5O3.ClH/c1-12-5-9-3-2-4-15(9)11(17)8-14-7-10(6-13-14)16(18)19;/h6-7,9,12H,2-5,8H2,1H3;1H |
| InChIKey | GTYMQJUDSKYPCU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|