About [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride
[2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride (PubChem CID 11964995) has the molecular formula C23H22Cl3N2OP
and a molecular weight of 479.78 g/mol. Its IUPAC name is [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride.
Molecular Properties
| Compound Name | [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride |
| PubChem CID | 11964995 |
| Molecular Formula | C23H22Cl3N2OP |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride |
| SMILES | CN(C)C(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C23H21Cl2N2OP.ClH/c1-27(2)23(28)26-22(21(24)25)29(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h3-17H,1-2H3;1H |
| InChIKey | ZRPISEKRXWIRGW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride?
The IUPAC name of [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride (CID 11964995) is [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride.
What is the SMILES notation for [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride?
The canonical SMILES for [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride is CN(C)C(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride?
The InChIKey is ZRPISEKRXWIRGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21Cl2N2OP.ClH/c1-27(2)23(28)26-22(21(24)25)29(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h3-17H,1-2H3;1H.
What are the key properties of [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride?
[2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride has a molecular weight of 479.78 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dichloro-1-(dimethylcarbamoylamino)ethenyl]-triphenylphosphanium chloride is sourced from PubChem (CID 11964995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).