C19H30N2O3 — CID 119650400
(4-butoxy-3-ethoxyphenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 119650400) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4-butoxy-3-ethoxyphenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-butoxy-3-ethoxyphenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119650400 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (4-butoxy-3-ethoxyphenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCCC2CNC)cc1OCC |
| InChI | InChI=1S/C19H30N2O3/c1-4-6-12-24-17-10-9-15(13-18(17)23-5-2)19(22)21-11-7-8-16(21)14-20-3/h9-10,13,16,20H,4-8,11-12,14H2,1-3H3 |
| InChIKey | YZOCVQCTUARLMP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|