C23H27ClN4O7S — CID 11965043
1-[7-[(5-chloro-1H-indol-2-yl)sulfonyl]-8a-(methoxymethyl)-5-oxospiro[6,8-dihydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-1'-yl]propane-1,2-dione (PubChem CID 11965043) has the molecular formula C23H27ClN4O7S and a molecular weight of 539.01 g/mol. Its IUPAC name is 1-[7-[(5-chloro-1H-indol-2-yl)sulfonyl]-8a-(methoxymethyl)-5-oxospiro[6,8-dihydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-1'-yl]propane-1,2-dione.
| Compound Name | 1-[7-[(5-chloro-1H-indol-2-yl)sulfonyl]-8a-(methoxymethyl)-5-oxospiro[6,8-dihydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-1'-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 11965043 |
| Molecular Formula | C23H27ClN4O7S |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 1-[7-[(5-chloro-1H-indol-2-yl)sulfonyl]-8a-(methoxymethyl)-5-oxospiro[6,8-dihydro-3H-[1,3]oxazolo[3,2-a]pyrazine-2,4'-piperidine]-1'-yl]propane-1,2-dione |
| SMILES | COCC12CN(S(=O)(=O)c3cc4cc(Cl)ccc4[nH]3)CC(=O)N1CC1(CCN(C(=O)C(C)=O)CC1)O2 |
| InChI | InChI=1S/C23H27ClN4O7S/c1-15(29)21(31)26-7-5-22(6-8-26)12-28-20(30)11-27(13-23(28,35-22)14-34-2)36(32,33)19-10-16-9-17(24)3-4-18(16)25-19/h3-4,9-10,25H,5-8,11-14H2,1-2H3 |
| InChIKey | HTCPOSBIAGZXSQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|