C13H24ClN3O2 — CID 119651125
1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one;hydrochloride (PubChem CID 119651125) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one;hydrochloride.
| Compound Name | 1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119651125 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)CN1CCCCC1=O.Cl |
| InChI | InChI=1S/C13H23N3O2.ClH/c1-14-9-11-5-4-8-16(11)13(18)10-15-7-3-2-6-12(15)17;/h11,14H,2-10H2,1H3;1H |
| InChIKey | RFNQJEDPBYPHLJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |