C16H20BrFN2O — CID 11965285
(4-bromo-3-fluorophenyl)-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 11965285) has the molecular formula C16H20BrFN2O and a molecular weight of 355.25 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-bromo-3-fluorophenyl)-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 11965285 |
| Molecular Formula | C16H20BrFN2O |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (4-bromo-3-fluorophenyl)-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)c(F)c1)N1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C16H20BrFN2O/c17-14-6-5-12(10-15(14)18)16(21)20-9-3-4-13(20)11-19-7-1-2-8-19/h5-6,10,13H,1-4,7-9,11H2/t13-/m0/s1 |
| InChIKey | FNKHUGITZCOWTN-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |