C23H26ClN7O4 — CID 11965420
N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-1-formyl-3-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]piperidin-4-yl]oxamide (PubChem CID 11965420) has the molecular formula C23H26ClN7O4 and a molecular weight of 499.96 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-1-formyl-3-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]piperidin-4-yl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-1-formyl-3-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]piperidin-4-yl]oxamide |
|---|---|
| PubChem CID | 11965420 |
| Molecular Formula | C23H26ClN7O4 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-1-formyl-3-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]piperidin-4-yl]oxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3CN(C=O)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)ccc2C1 |
| InChI | InChI=1S/C23H26ClN7O4/c1-30-8-6-16-14(11-30)2-4-18(26-16)21(33)28-19-12-31(13-32)9-7-17(19)27-22(34)23(35)29-20-5-3-15(24)10-25-20/h2-5,10,13,17,19H,6-9,11-12H2,1H3,(H,27,34)(H,28,33)(H,25,29,35)/t17-,19+/m0/s1 |
| InChIKey | IXJYSOAEMQVYHR-PKOBYXMFSA-N |
| XLogP | 0.20 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|