C17H22N2O4 — CID 119655442
N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 119655442) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 119655442 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | CN(CC(C)(C)CN)C(=O)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C17H22N2O4/c1-17(2,10-18)11-19(3)15(20)9-22-13-6-4-12-5-7-16(21)23-14(12)8-13/h4-8H,9-11,18H2,1-3H3 |
| InChIKey | IANSUIKGZJKLNJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|