C18H30N2O3 — CID 119656853
N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyphenoxy)-N-methylbutanamide (PubChem CID 119656853) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyphenoxy)-N-methylbutanamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyphenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 119656853 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyphenoxy)-N-methylbutanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N(C)CC(C)(C)CN |
| InChI | InChI=1S/C18H30N2O3/c1-5-22-15-9-6-7-10-16(15)23-12-8-11-17(21)20(4)14-18(2,3)13-19/h6-7,9-10H,5,8,11-14,19H2,1-4H3 |
| InChIKey | CGHIQKBTXMVJHT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|