About N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide
N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide (PubChem CID 11965693) has the molecular formula C12H10F3N3O5S
and a molecular weight of 365.29 g/mol. Its IUPAC name is N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide |
| PubChem CID | 11965693 |
| Molecular Formula | C12H10F3N3O5S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide |
| SMILES | CC(=O)c1cc2c(=O)n(NS(C)(=O)=O)c(=O)[nH]c2cc1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O5S/c1-5(19)6-3-7-9(4-8(6)12(13,14)15)16-11(21)18(10(7)20)17-24(2,22)23/h3-4,17H,1-2H3,(H,16,21) |
| InChIKey | KWDHMVDQHZJANI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
The IUPAC name of N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide (CID 11965693) is N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
The canonical SMILES for N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide is CC(=O)c1cc2c(=O)n(NS(C)(=O)=O)c(=O)[nH]c2cc1C(F)(F)F.
What is the InChIKey of N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
The InChIKey is KWDHMVDQHZJANI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N3O5S/c1-5(19)6-3-7-9(4-8(6)12(13,14)15)16-11(21)18(10(7)20)17-24(2,22)23/h3-4,17H,1-2H3,(H,16,21).
What are the key properties of N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide?
N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide has a molecular weight of 365.29 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-acetyl-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]methanesulfonamide is sourced from PubChem (CID 11965693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).