C18H27ClN2O3 — CID 119658659
N-(3-amino-4-methylpentyl)-6-methoxy-N-methyl-2H-chromene-3-carboxamide;hydrochloride (PubChem CID 119658659) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-6-methoxy-N-methyl-2H-chromene-3-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-6-methoxy-N-methyl-2H-chromene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119658659 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-6-methoxy-N-methyl-2H-chromene-3-carboxamide;hydrochloride |
| SMILES | COc1ccc2c(c1)C=C(C(=O)N(C)CCC(N)C(C)C)CO2.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-12(2)16(19)7-8-20(3)18(21)14-9-13-10-15(22-4)5-6-17(13)23-11-14;/h5-6,9-10,12,16H,7-8,11,19H2,1-4H3;1H |
| InChIKey | KPOKFBSTFHHAJX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |