C19H31ClN2O3S — CID 119659238
N-(3-amino-4-methylpentyl)-4-cyclopentylsulfonyl-N-methylbenzamide;hydrochloride (PubChem CID 119659238) has the molecular formula C19H31ClN2O3S and a molecular weight of 402.99 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-4-cyclopentylsulfonyl-N-methylbenzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-4-cyclopentylsulfonyl-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119659238 |
| Molecular Formula | C19H31ClN2O3S |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-4-cyclopentylsulfonyl-N-methylbenzamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1ccc(S(=O)(=O)C2CCCC2)cc1.Cl |
| InChI | InChI=1S/C19H30N2O3S.ClH/c1-14(2)18(20)12-13-21(3)19(22)15-8-10-17(11-9-15)25(23,24)16-6-4-5-7-16;/h8-11,14,16,18H,4-7,12-13,20H2,1-3H3;1H |
| InChIKey | KIZLNEBVYHVKJM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |