C20H31ClN4O — CID 119659628
N-(3-amino-4-methylpentyl)-1-benzyl-5-ethyl-N-methylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119659628) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-1-benzyl-5-ethyl-N-methylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-1-benzyl-5-ethyl-N-methylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119659628 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-1-benzyl-5-ethyl-N-methylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCc1c(C(=O)N(C)CCC(N)C(C)C)cnn1Cc1ccccc1.Cl |
| InChI | InChI=1S/C20H30N4O.ClH/c1-5-19-17(20(25)23(4)12-11-18(21)15(2)3)13-22-24(19)14-16-9-7-6-8-10-16;/h6-10,13,15,18H,5,11-12,14,21H2,1-4H3;1H |
| InChIKey | YRRSJTAUFUIENC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |