C14H23ClN2OS — CID 119659793
N-(3-amino-4-methylpentyl)-3-(4-chlorothiophen-2-yl)-N-methylpropanamide (PubChem CID 119659793) has the molecular formula C14H23ClN2OS and a molecular weight of 302.87 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-(4-chlorothiophen-2-yl)-N-methylpropanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-3-(4-chlorothiophen-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 119659793 |
| Molecular Formula | C14H23ClN2OS |
| Molecular Weight | 302.87 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-(4-chlorothiophen-2-yl)-N-methylpropanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCc1cc(Cl)cs1 |
| InChI | InChI=1S/C14H23ClN2OS/c1-10(2)13(16)6-7-17(3)14(18)5-4-12-8-11(15)9-19-12/h8-10,13H,4-7,16H2,1-3H3 |
| InChIKey | OOVBPJOTTQHQHC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |