C18H30ClN3O4 — CID 119659798
N-(3-amino-4-methylpentyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methylpropanamide;hydrochloride (PubChem CID 119659798) has the molecular formula C18H30ClN3O4 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methylpropanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119659798 |
| Molecular Formula | C18H30ClN3O4 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methylpropanamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCN1C(=O)C2C3CCC(O3)C2C1=O.Cl |
| InChI | InChI=1S/C18H29N3O4.ClH/c1-10(2)11(19)6-8-20(3)14(22)7-9-21-17(23)15-12-4-5-13(25-12)16(15)18(21)24;/h10-13,15-16H,4-9,19H2,1-3H3;1H |
| InChIKey | QIDJQWCVPQEFCN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|