C17H33N3O2 — CID 119660200
N-(3-amino-4-methylpentyl)-1-butanoyl-N-methylpiperidine-3-carboxamide (PubChem CID 119660200) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-1-butanoyl-N-methylpiperidine-3-carboxamide.
| Compound Name | N-(3-amino-4-methylpentyl)-1-butanoyl-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119660200 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-1-butanoyl-N-methylpiperidine-3-carboxamide |
| SMILES | CCCC(=O)N1CCCC(C(=O)N(C)CCC(N)C(C)C)C1 |
| InChI | InChI=1S/C17H33N3O2/c1-5-7-16(21)20-10-6-8-14(12-20)17(22)19(4)11-9-15(18)13(2)3/h13-15H,5-12,18H2,1-4H3 |
| InChIKey | BPMDJRDZMLYXKJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |