C7H6IN — CID 11966049
7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 11966049) has the molecular formula C7H6IN and a molecular weight of 231.04 g/mol. Its IUPAC name is 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 11966049 |
| Molecular Formula | C7H6IN |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | IC1Cc2cnccc21 |
| InChI | InChI=1S/C7H6IN/c8-7-3-5-4-9-2-1-6(5)7/h1-2,4,7H,3H2 |
| InChIKey | SIUCIJYHEIUIEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|