About 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene
7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 11966049) has the molecular formula C7H6IN
and a molecular weight of 231.04 g/mol. Its IUPAC name is 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene.
Molecular Properties
| Compound Name | 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene |
| PubChem CID | 11966049 |
| Molecular Formula | C7H6IN |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | IC1Cc2cnccc21 |
| InChI | InChI=1S/C7H6IN/c8-7-3-5-4-9-2-1-6(5)7/h1-2,4,7H,3H2 |
| InChIKey | SIUCIJYHEIUIEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
The IUPAC name of 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene (CID 11966049) is 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene.
What is the SMILES notation for 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
The canonical SMILES for 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene is IC1Cc2cnccc21.
What is the InChIKey of 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
The InChIKey is SIUCIJYHEIUIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6IN/c8-7-3-5-4-9-2-1-6(5)7/h1-2,4,7H,3H2.
What are the key properties of 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene has a molecular weight of 231.04 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-3-azabicyclo[4.2.0]octa-1(6),2,4-triene is sourced from PubChem (CID 11966049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).