C15H29ClN4O — CID 119660642
N-(3-amino-4-methylpentyl)-5-tert-butyl-N-methyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119660642) has the molecular formula C15H29ClN4O and a molecular weight of 316.88 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-5-tert-butyl-N-methyl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-5-tert-butyl-N-methyl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119660642 |
| Molecular Formula | C15H29ClN4O |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-5-tert-butyl-N-methyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1cc(C(C)(C)C)[nH]n1.Cl |
| InChI | InChI=1S/C15H28N4O.ClH/c1-10(2)11(16)7-8-19(6)14(20)12-9-13(18-17-12)15(3,4)5;/h9-11H,7-8,16H2,1-6H3,(H,17,18);1H |
| InChIKey | BFPYMFITUOJXRL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |