C17H27FN2O2 — CID 119661444
N-(3-amino-4-methylpentyl)-2-(2-fluorophenoxy)-N-methylbutanamide (PubChem CID 119661444) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-2-(2-fluorophenoxy)-N-methylbutanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-2-(2-fluorophenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 119661444 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-2-(2-fluorophenoxy)-N-methylbutanamide |
| SMILES | CCC(Oc1ccccc1F)C(=O)N(C)CCC(N)C(C)C |
| InChI | InChI=1S/C17H27FN2O2/c1-5-15(22-16-9-7-6-8-13(16)18)17(21)20(4)11-10-14(19)12(2)3/h6-9,12,14-15H,5,10-11,19H2,1-4H3 |
| InChIKey | BGQBVIILEYPBMJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |