C20H36ClN3O3 — CID 119661802
4-[4-(3-aminopropoxy)piperidine-1-carbonyl]-1-(4-methylcyclohexyl)pyrrolidin-2-one;hydrochloride (PubChem CID 119661802) has the molecular formula C20H36ClN3O3 and a molecular weight of 401.98 g/mol. Its IUPAC name is 4-[4-(3-aminopropoxy)piperidine-1-carbonyl]-1-(4-methylcyclohexyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 4-[4-(3-aminopropoxy)piperidine-1-carbonyl]-1-(4-methylcyclohexyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119661802 |
| Molecular Formula | C20H36ClN3O3 |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 4-[4-(3-aminopropoxy)piperidine-1-carbonyl]-1-(4-methylcyclohexyl)pyrrolidin-2-one;hydrochloride |
| SMILES | CC1CCC(N2CC(C(=O)N3CCC(OCCCN)CC3)CC2=O)CC1.Cl |
| InChI | InChI=1S/C20H35N3O3.ClH/c1-15-3-5-17(6-4-15)23-14-16(13-19(23)24)20(25)22-10-7-18(8-11-22)26-12-2-9-21;/h15-18H,2-14,21H2,1H3;1H |
| InChIKey | WOEHOWWHGHJYSY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|