C20H39O2- — CID 11966211
3,7,11,15-tetramethylhexadecanoate (PubChem CID 11966211) has the molecular formula C20H39O2- and a molecular weight of 311.53 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadecanoate.
| Compound Name | 3,7,11,15-tetramethylhexadecanoate |
|---|---|
| PubChem CID | 11966211 |
| Molecular Formula | C20H39O2- |
| Molecular Weight | 311.53 g/mol |
| Exact Mass | 311.30 |
| IUPAC Name | 3,7,11,15-tetramethylhexadecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h16-19H,6-15H2,1-5H3,(H,21,22)/p-1 |
| InChIKey | RLCKHJSFHOZMDR-UHFFFAOYSA-M |
| XLogP | 5.20 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |