2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid

C12H20O4 — CID 11966225

IUPAC2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid
SMILESCC(O)CCC[C@H]1C(=O)CC[C@@H]1CC(=O)O
InChIInChI=1S/C12H20O4/c1-8(13)3-2-4-10-9(7-12(15)16)5-6-11(10)14/h8-10,13H,2-7H2,1H3,(H,15,16)/t8?,9-,10-/m1/s1
InChIKeyZJPORBFEYXKGKA-VXRWAFEHSA-N
MW228.29 g/mol
LogP1.61
Rot. Bonds6

About 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid

2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid (PubChem CID 11966225) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid
PubChem CID11966225
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid
SMILESCC(O)CCC[C@H]1C(=O)CC[C@@H]1CC(=O)O
InChIInChI=1S/C12H20O4/c1-8(13)3-2-4-10-9(7-12(15)16)5-6-11(10)14/h8-10,13H,2-7H2,1H3,(H,15,16)/t8?,9-,10-/m1/s1
InChIKeyZJPORBFEYXKGKA-VXRWAFEHSA-N
XLogP1.61
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 51.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid?
The IUPAC name of 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid (CID 11966225) is 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid.
What is the SMILES notation for 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid?
The canonical SMILES for 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid is CC(O)CCC[C@H]1C(=O)CC[C@@H]1CC(=O)O.
What is the InChIKey of 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid?
The InChIKey is ZJPORBFEYXKGKA-VXRWAFEHSA-N. The full InChI is InChI=1S/C12H20O4/c1-8(13)3-2-4-10-9(7-12(15)16)5-6-11(10)14/h8-10,13H,2-7H2,1H3,(H,15,16)/t8?,9-,10-/m1/s1.
What are the key properties of 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid?
2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid has a molecular weight of 228.29 g/mol, XLogP of 1.61, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid is sourced from PubChem (CID 11966225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).