C19H27F3N2O2 — CID 119662270
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-methyl-3-[3-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 119662270) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-methyl-3-[3-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-methyl-3-[3-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 119662270 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-methyl-3-[3-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)C(=O)N1CCC(OCCCN)CC1 |
| InChI | InChI=1S/C19H27F3N2O2/c1-14(12-15-4-2-5-16(13-15)19(20,21)22)18(25)24-9-6-17(7-10-24)26-11-3-8-23/h2,4-5,13-14,17H,3,6-12,23H2,1H3 |
| InChIKey | YGYMNIMERWEKRA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|