C24H17N5 — CID 11966286
25,26,27,28,29-pentazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,7,9,11,13,15,17,19,21,23-tridecaene (PubChem CID 11966286) has the molecular formula C24H17N5 and a molecular weight of 375.44 g/mol. Its IUPAC name is 25,26,27,28,29-pentazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,7,9,11,13,15,17,19,21,23-tridecaene.
| Compound Name | 25,26,27,28,29-pentazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,7,9,11,13,15,17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 11966286 |
| Molecular Formula | C24H17N5 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 25,26,27,28,29-pentazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,7,9,11,13,15,17,19,21,23-tridecaene |
| SMILES | C1=Cc2nc1cc1ccc(cc3ccc(cc4ccc(cc5nc2C=C5)[nH]4)[nH]3)[nH]1 |
| InChI | InChI=1S/C24H17N5/c1-2-16-12-18-4-6-20(27-18)14-22-8-10-24(29-22)23-9-7-21(28-23)13-19-5-3-17(26-19)11-15(1)25-16/h1-14,25-27H/b15-11-,16-12-,17-11-,18-12-,19-13-,20-14-,21-13-,22-14-,24-23- |
| InChIKey | QWUOLXQBACMUKB-DABHNVCVSA-N |
| XLogP | 5.70 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |