About (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid
(2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid (PubChem CID 11966288) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| PubChem CID | 11966288 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC=N1 |
| InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/t4-/m1/s1 |
| InChIKey | DWAKNKKXGALPNW-SCSAIBSYSA-N |
| XLogP | 0.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The IUPAC name of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid (CID 11966288) is (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
What is the SMILES notation for (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The canonical SMILES for (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid is O=C(O)[C@H]1CCC=N1.
What is the InChIKey of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The InChIKey is DWAKNKKXGALPNW-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/t4-/m1/s1.
What are the key properties of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
(2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid has a molecular weight of 113.12 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,4-dihydro-2H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 11966288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).