C17H26ClN3O5 — CID 119663370
1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2-nitrophenoxy)propan-1-one;hydrochloride (PubChem CID 119663370) has the molecular formula C17H26ClN3O5 and a molecular weight of 387.86 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2-nitrophenoxy)propan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2-nitrophenoxy)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119663370 |
| Molecular Formula | C17H26ClN3O5 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2-nitrophenoxy)propan-1-one;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)CCOc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H25N3O5.ClH/c18-9-3-12-24-14-6-10-19(11-7-14)17(21)8-13-25-16-5-2-1-4-15(16)20(22)23;/h1-2,4-5,14H,3,6-13,18H2;1H |
| InChIKey | XVPRHHKDLAJBMG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|