C16H33ClN2O2 — CID 119663849
1-[4-(3-aminopropoxy)piperidin-1-yl]-3,5-dimethylhexan-1-one;hydrochloride (PubChem CID 119663849) has the molecular formula C16H33ClN2O2 and a molecular weight of 320.91 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-3,5-dimethylhexan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3,5-dimethylhexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119663849 |
| Molecular Formula | C16H33ClN2O2 |
| Molecular Weight | 320.91 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3,5-dimethylhexan-1-one;hydrochloride |
| SMILES | CC(C)CC(C)CC(=O)N1CCC(OCCCN)CC1.Cl |
| InChI | InChI=1S/C16H32N2O2.ClH/c1-13(2)11-14(3)12-16(19)18-8-5-15(6-9-18)20-10-4-7-17;/h13-15H,4-12,17H2,1-3H3;1H |
| InChIKey | DYLBHQFSITXTIP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.91 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|