About [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane
[(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 11966388) has the molecular formula C34H38O3S2Si
and a molecular weight of 586.90 g/mol. Its IUPAC name is [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane.
Molecular Properties
| Compound Name | [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane |
| PubChem CID | 11966388 |
| Molecular Formula | C34H38O3S2Si |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | Cc1ccc(S(=O)/C=C(\CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H38O3S2Si/c1-27-16-20-29(21-17-27)38(35)26-31(39(36)30-22-18-28(2)19-23-30)24-25-37-40(34(3,4)5,32-12-8-6-9-13-32)33-14-10-7-11-15-33/h6-23,26H,24-25H2,1-5H3/b31-26+ |
| InChIKey | BKBFOUYLWRAUJC-GKPLWNPISA-N |
| XLogP | 7.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane?
The IUPAC name of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane (CID 11966388) is [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane.
What is the SMILES notation for [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane?
The canonical SMILES for [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane is Cc1ccc(S(=O)/C=C(\CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane?
The InChIKey is BKBFOUYLWRAUJC-GKPLWNPISA-N. The full InChI is InChI=1S/C34H38O3S2Si/c1-27-16-20-29(21-17-27)38(35)26-31(39(36)30-22-18-28(2)19-23-30)24-25-37-40(34(3,4)5,32-12-8-6-9-13-32)33-14-10-7-11-15-33/h6-23,26H,24-25H2,1-5H3/b31-26+.
What are the key properties of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane?
[(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane has a molecular weight of 586.90 g/mol, XLogP of 7.03, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-diphenylsilane is sourced from PubChem (CID 11966388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).