C19H27ClN2O3 — CID 119664624
[4-(3-aminopropoxy)piperidin-1-yl]-(3,7-dimethyl-1-benzofuran-2-yl)methanone;hydrochloride (PubChem CID 119664624) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(3,7-dimethyl-1-benzofuran-2-yl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(3,7-dimethyl-1-benzofuran-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119664624 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(3,7-dimethyl-1-benzofuran-2-yl)methanone;hydrochloride |
| SMILES | Cc1c(C(=O)N2CCC(OCCCN)CC2)oc2c(C)cccc12.Cl |
| InChI | InChI=1S/C19H26N2O3.ClH/c1-13-5-3-6-16-14(2)18(24-17(13)16)19(22)21-10-7-15(8-11-21)23-12-4-9-20;/h3,5-6,15H,4,7-12,20H2,1-2H3;1H |
| InChIKey | IMKINKGJMALWJD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|