C20H32ClN3O3 — CID 119665267
N-(1-aminohexan-2-yl)-1-(2-phenoxyacetyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119665267) has the molecular formula C20H32ClN3O3 and a molecular weight of 397.95 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(2-phenoxyacetyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-1-(2-phenoxyacetyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119665267 |
| Molecular Formula | C20H32ClN3O3 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(2-phenoxyacetyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C1CCCN(C(=O)COc2ccccc2)C1.Cl |
| InChI | InChI=1S/C20H31N3O3.ClH/c1-2-3-9-17(13-21)22-20(25)16-8-7-12-23(14-16)19(24)15-26-18-10-5-4-6-11-18;/h4-6,10-11,16-17H,2-3,7-9,12-15,21H2,1H3,(H,22,25);1H |
| InChIKey | ZGRLYZIRYYOOOW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |