C35H38O8S — CID 11966555
[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11966555) has the molecular formula C35H38O8S and a molecular weight of 618.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11966555 |
| Molecular Formula | C35H38O8S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H38O8S/c1-26-18-20-30(21-19-26)44(36,37)42-25-31-32(39-22-27-12-6-3-7-13-27)33(40-23-28-14-8-4-9-15-28)34(35(38-2)43-31)41-24-29-16-10-5-11-17-29/h3-21,31-35H,22-25H2,1-2H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | DPWAXHFUEINODS-KJQSSVQNSA-N |
| XLogP | 5.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|