C13H18BrClF2N2O — CID 119665762
N-(1-aminohexan-2-yl)-4-bromo-2,6-difluorobenzamide;hydrochloride (PubChem CID 119665762) has the molecular formula C13H18BrClF2N2O and a molecular weight of 371.65 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-bromo-2,6-difluorobenzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-bromo-2,6-difluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119665762 |
| Molecular Formula | C13H18BrClF2N2O |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-bromo-2,6-difluorobenzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1c(F)cc(Br)cc1F.Cl |
| InChI | InChI=1S/C13H17BrF2N2O.ClH/c1-2-3-4-9(7-17)18-13(19)12-10(15)5-8(14)6-11(12)16;/h5-6,9H,2-4,7,17H2,1H3,(H,18,19);1H |
| InChIKey | UKHUCCJTUICHCN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |