C15H22BrN3O2 — CID 119665856
N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-3-bromobenzamide (PubChem CID 119665856) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-3-bromobenzamide.
| Compound Name | N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 119665856 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-3-bromobenzamide |
| SMILES | CCCCC(CN)NC(=O)CNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-2-3-7-13(9-17)19-14(20)10-18-15(21)11-5-4-6-12(16)8-11/h4-6,8,13H,2-3,7,9-10,17H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | ZFYOMPBBICTIDA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |