C27H35F3N2O8SSi — CID 11966637
methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate (PubChem CID 11966637) has the molecular formula C27H35F3N2O8SSi and a molecular weight of 632.73 g/mol. Its IUPAC name is methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate.
| Compound Name | methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate |
|---|---|
| PubChem CID | 11966637 |
| Molecular Formula | C27H35F3N2O8SSi |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate |
| SMILES | COC(=O)C(C[C@@]12C=CC(=O)C[C@@H]1CCN(S(=O)(=O)c1ccccc1)C2=O)N(COCC[Si](C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N2O8SSi/c1-39-23(34)22(31(25(36)27(28,29)30)18-40-14-15-42(2,3)4)17-26-12-10-20(33)16-19(26)11-13-32(24(26)35)41(37,38)21-8-6-5-7-9-21/h5-10,12,19,22H,11,13-18H2,1-4H3/t19-,22?,26-/m0/s1 |
| InChIKey | UIZVTQQVQGVKON-CLSOUDOTSA-N |
| XLogP | 3.37 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|