C16H24ClF3N2O2 — CID 119667198
N-(1-aminohexan-2-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide;hydrochloride (PubChem CID 119667198) has the molecular formula C16H24ClF3N2O2 and a molecular weight of 368.83 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119667198 |
| Molecular Formula | C16H24ClF3N2O2 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C(C)Oc1ccccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C16H23F3N2O2.ClH/c1-3-4-7-12(10-20)21-15(22)11(2)23-14-9-6-5-8-13(14)16(17,18)19;/h5-6,8-9,11-12H,3-4,7,10,20H2,1-2H3,(H,21,22);1H |
| InChIKey | MZEJUDOCYRDGCF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |