C14H21ClN2O3 — CID 119667368
N-(1-aminohexan-2-yl)-1,3-benzodioxole-5-carboxamide;hydrochloride (PubChem CID 119667368) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1,3-benzodioxole-5-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-1,3-benzodioxole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119667368 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1,3-benzodioxole-5-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C14H20N2O3.ClH/c1-2-3-4-11(8-15)16-14(17)10-5-6-12-13(7-10)19-9-18-12;/h5-7,11H,2-4,8-9,15H2,1H3,(H,16,17);1H |
| InChIKey | NKHRXYMJUUCOKD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |