C15H25ClN2O3S — CID 119667537
N-(1-aminohexan-2-yl)-2-ethylsulfonylbenzamide;hydrochloride (PubChem CID 119667537) has the molecular formula C15H25ClN2O3S and a molecular weight of 348.90 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-ethylsulfonylbenzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-ethylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119667537 |
| Molecular Formula | C15H25ClN2O3S |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-ethylsulfonylbenzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccccc1S(=O)(=O)CC.Cl |
| InChI | InChI=1S/C15H24N2O3S.ClH/c1-3-5-8-12(11-16)17-15(18)13-9-6-7-10-14(13)21(19,20)4-2;/h6-7,9-10,12H,3-5,8,11,16H2,1-2H3,(H,17,18);1H |
| InChIKey | HZTAYIGSBYQLHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |