C39H48O9 — CID 11966763
[2-acetyloxy-4-[(1R,5R,7R)-2-acetyloxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)-4,9-dioxobicyclo[3.3.1]non-2-ene-3-carbonyl]phenyl] acetate (PubChem CID 11966763) has the molecular formula C39H48O9 and a molecular weight of 660.80 g/mol. Its IUPAC name is [2-acetyloxy-4-[(1R,5R,7R)-2-acetyloxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)-4,9-dioxobicyclo[3.3.1]non-2-ene-3-carbonyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[(1R,5R,7R)-2-acetyloxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)-4,9-dioxobicyclo[3.3.1]non-2-ene-3-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 11966763 |
| Molecular Formula | C39H48O9 |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | [2-acetyloxy-4-[(1R,5R,7R)-2-acetyloxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)-4,9-dioxobicyclo[3.3.1]non-2-ene-3-carbonyl]phenyl] acetate |
| SMILES | CC(=O)OC1=C(C(=O)c2ccc(OC(C)=O)c(OC(C)=O)c2)C(=O)[C@]2(CC=C(C)C)C[C@@H](CC=C(C)C)C(C)(C)[C@@]1(CC=C(C)C)C2=O |
| InChI | InChI=1S/C39H48O9/c1-22(2)12-14-29-21-38(18-16-23(3)4)34(44)32(33(43)28-13-15-30(46-25(7)40)31(20-28)47-26(8)41)35(48-27(9)42)39(36(38)45,37(29,10)11)19-17-24(5)6/h12-13,15-17,20,29H,14,18-19,21H2,1-11H3/t29-,38+,39-/m1/s1 |
| InChIKey | VBZTYQWQAREOGH-VSVILQIWSA-N |
| XLogP | 7.78 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|