C16H20BrN3O2 — CID 119668885
N-(1-aminohexan-2-yl)-8-bromo-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 119668885) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-8-bromo-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-(1-aminohexan-2-yl)-8-bromo-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 119668885 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(1-aminohexan-2-yl)-8-bromo-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCCCC(CN)NC(=O)c1cc(=O)[nH]c2c(Br)cccc12 |
| InChI | InChI=1S/C16H20BrN3O2/c1-2-3-5-10(9-18)19-16(22)12-8-14(21)20-15-11(12)6-4-7-13(15)17/h4,6-8,10H,2-3,5,9,18H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | BWEZGWKIPVFUFS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |