C38H43N7O6 — CID 11966910
[3-(acridin-9-ylamino)-5-(ethoxycarbonylamino)phenyl]methyl 5-[[5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]amino]-5-oxopentanoate (PubChem CID 11966910) has the molecular formula C38H43N7O6 and a molecular weight of 693.81 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(ethoxycarbonylamino)phenyl]methyl 5-[[5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]amino]-5-oxopentanoate.
| Compound Name | [3-(acridin-9-ylamino)-5-(ethoxycarbonylamino)phenyl]methyl 5-[[5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 11966910 |
| Molecular Formula | C38H43N7O6 |
| Molecular Weight | 693.81 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(ethoxycarbonylamino)phenyl]methyl 5-[[5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]amino]-5-oxopentanoate |
| SMILES | CCOC(=O)Nc1cc(COC(=O)CCCC(=O)Nc2cc(C(=O)NCCN(C)C)n(C)c2)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C38H43N7O6/c1-5-50-38(49)42-27-20-25(19-26(21-27)41-36-29-11-6-8-13-31(29)43-32-14-9-7-12-30(32)36)24-51-35(47)16-10-15-34(46)40-28-22-33(45(4)23-28)37(48)39-17-18-44(2)3/h6-9,11-14,19-23H,5,10,15-18,24H2,1-4H3,(H,39,48)(H,40,46)(H,41,43)(H,42,49) |
| InChIKey | RKOGPJXKLZYXNA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|