C13H21ClN2O2 — CID 119670707
3-amino-N-(4-ethoxyphenyl)-2,2-dimethylpropanamide;hydrochloride (PubChem CID 119670707) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 3-amino-N-(4-ethoxyphenyl)-2,2-dimethylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-(4-ethoxyphenyl)-2,2-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119670707 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-amino-N-(4-ethoxyphenyl)-2,2-dimethylpropanamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)C(C)(C)CN)cc1.Cl |
| InChI | InChI=1S/C13H20N2O2.ClH/c1-4-17-11-7-5-10(6-8-11)15-12(16)13(2,3)9-14;/h5-8H,4,9,14H2,1-3H3,(H,15,16);1H |
| InChIKey | AKLBYNSZFRUUDC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |