C38H35FN5O7PS — CID 11967101
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(hydroxy)phosphinothioyl]oxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 11967101) has the molecular formula C38H35FN5O7PS and a molecular weight of 755.77 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(hydroxy)phosphinothioyl]oxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(hydroxy)phosphinothioyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 11967101 |
| Molecular Formula | C38H35FN5O7PS |
| Molecular Weight | 755.77 g/mol |
| Exact Mass | 755.20 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(hydroxy)phosphinothioyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2OP(O)(F)=S)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H35FN5O7PS/c1-47-29-17-13-27(14-18-29)38(26-11-7-4-8-12-26,28-15-19-30(48-2)20-16-28)49-22-32-31(51-52(39,46)53)21-33(50-32)44-24-42-34-35(40-23-41-36(34)44)43-37(45)25-9-5-3-6-10-25/h3-20,23-24,31-33H,21-22H2,1-2H3,(H,46,53)(H,40,41,43,45)/t31-,32+,33+,52?/m0/s1 |
| InChIKey | NFSCSFIBCRVBPA-APXSLQGZSA-N |
| XLogP | 6.96 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.77 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|