C47H52O7Si — CID 11967105
(E)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-en-1-one (PubChem CID 11967105) has the molecular formula C47H52O7Si and a molecular weight of 757.01 g/mol. Its IUPAC name is (E)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-en-1-one.
| Compound Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 11967105 |
| Molecular Formula | C47H52O7Si |
| Molecular Weight | 757.01 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]but-2-en-1-one |
| SMILES | CO[C@H]1O[C@H](C(=O)/C=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H52O7Si/c1-47(2,3)55(39-27-16-8-17-28-39,40-29-18-9-19-30-40)53-32-20-31-41(48)42-43(50-33-36-21-10-5-11-22-36)44(51-34-37-23-12-6-13-24-37)45(46(49-4)54-42)52-35-38-25-14-7-15-26-38/h5-31,42-46H,32-35H2,1-4H3/b31-20+/t42-,43-,44+,45-,46+/m1/s1 |
| InChIKey | OWOOVEPAFAOGHS-ZOPAYSKRSA-N |
| XLogP | 7.82 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.01 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|