C15H23ClN2O4 — CID 119671461
(2S)-N-(3,4,5-trimethoxyphenyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 119671461) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is (2S)-N-(3,4,5-trimethoxyphenyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-(3,4,5-trimethoxyphenyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119671461 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2S)-N-(3,4,5-trimethoxyphenyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | COc1cc(NC(=O)[C@@H]2CCCCN2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-19-12-8-10(9-13(20-2)14(12)21-3)17-15(18)11-6-4-5-7-16-11;/h8-9,11,16H,4-7H2,1-3H3,(H,17,18);1H/t11-;/m0./s1 |
| InChIKey | LLCGQMSLONRTPH-MERQFXBCSA-N |
| XLogP | 2.21 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |