C21H34N2O — CID 119671508
N-[2,6-di(propan-2-yl)phenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119671508) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119671508 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CC(C)C1CCCNC1 |
| InChI | InChI=1S/C21H34N2O/c1-14(2)18-9-6-10-19(15(3)4)21(18)23-20(24)12-16(5)17-8-7-11-22-13-17/h6,9-10,14-17,22H,7-8,11-13H2,1-5H3,(H,23,24) |
| InChIKey | OMSAGFJUQXKYJC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |