C48H54FeN2O2P2+2 — CID 11967227
(R)-(+)-1,1'-Bis(diphenylphosphino)-2,2'-bis(N,N-diisopropylamido)ferrocene, (R)-CTH-JAFAPhos (PubChem CID 11967227) has the molecular formula C48H54FeN2O2P2+2 and a molecular weight of 808.77 g/mol.
| Compound Name | (R)-(+)-1,1'-Bis(diphenylphosphino)-2,2'-bis(N,N-diisopropylamido)ferrocene, (R)-CTH-JAFAPhos |
|---|---|
| PubChem CID | 11967227 |
| Molecular Formula | C48H54FeN2O2P2+2 |
| Molecular Weight | 808.77 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | — |
| SMILES | CC(C)N(C(=O)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)C(C)C.CC(C)N(C(=O)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)C(C)C.[Fe+2] |
| InChI | InChI=1S/2C24H27NOP.Fe/c2*1-18(2)25(19(3)4)24(26)22-16-11-17-23(22)27(20-12-7-5-8-13-20)21-14-9-6-10-15-21;/h2*5-19H,1-4H3;/q;;+2 |
| InChIKey | VKZUQQDPLUCZCH-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.77 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|