C17H29ClN2O — CID 119672598
4-amino-N,N-bis(3-methylbutyl)benzamide;hydrochloride (PubChem CID 119672598) has the molecular formula C17H29ClN2O and a molecular weight of 312.89 g/mol. Its IUPAC name is 4-amino-N,N-bis(3-methylbutyl)benzamide;hydrochloride.
| Compound Name | 4-amino-N,N-bis(3-methylbutyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119672598 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-amino-N,N-bis(3-methylbutyl)benzamide;hydrochloride |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C17H28N2O.ClH/c1-13(2)9-11-19(12-10-14(3)4)17(20)15-5-7-16(18)8-6-15;/h5-8,13-14H,9-12,18H2,1-4H3;1H |
| InChIKey | RESPWZQWFDTCQT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|